CH3OH + CH2=C(CH3)COOH = CH2=C(CH3)COOCH3 | Balanced | Chemical Reaction Details

methanol + Methacrylic acid = Methyl methacrylate | Temperature: t0, Condition H+

Advertisement

Table of Content

CH3OH + CH2=C(CH3)COOHCH2=C(CH3)COOCH3
methanol Methacrylic acid; alpha-Methylacrylic acid; 2-Methyl-2-propenoic acid; 2-Methylacrylic acid; 2-Methylpropenoic acid Methyl methacrylate; Methyl isopropenoate; 2-Methyl-2-propenoic acid methyl; NA-1247; RCRA waste number U-162; NCI-C-50680; MMA; 2-Methylpropenoic acid methyl ester; Methacrylic acid methyl ester; 2-Methyl-2-propenoic acid methyl ester; Methyl methacrylate monomer; 2-Methylpropenoic acid methyl; 2-Methylacrylic acid methyl; Methacrylic acid methyl; 2-Methylenepropanoic acid methyl
(dung dịch) (dung dịch) (rắn)
(không màu)
1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Advertisement

Further information about equation CH3OH + CH2=C(CH3)COOH → CH2=C(CH3)COOCH3

What is reaction condition of CH3OH (methanol) reacts with CH2=C(CH3)COOH (Methacrylic acid; alpha-Methylacrylic acid; 2-Methyl-2-propenoic acid; 2-Methylacrylic acid; 2-Methylpropenoic acid) ?

Temperature: t0 Solvent: H+

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce CH2=C(CH3)COOCH3 (Methyl methacrylate; Methyl isopropenoate; 2-Methyl-2-propenoic acid methyl; NA-1247; RCRA waste number U-162; NCI-C-50680; MMA; 2-Methylpropenoic acid methyl ester; Methacrylic acid methyl ester; 2-Methyl-2-propenoic acid methyl ester; Methyl methacrylate monomer; 2-Methylpropenoic acid methyl; 2-Methylacrylic acid methyl; Methacrylic acid methyl; 2-Methylenepropanoic acid methyl) ?

CH2=C(CH3)COOH reacts with NaOH

In a full sentence, you can also say CH3OH (methanol) reacts with CH2=C(CH3)COOH (Methacrylic acid; alpha-Methylacrylic acid; 2-Methyl-2-propenoic acid; 2-Methylacrylic acid; 2-Methylpropenoic acid) and produce CH2=C(CH3)COOCH3 (Methyl methacrylate; Methyl isopropenoate; 2-Methyl-2-propenoic acid methyl; NA-1247; RCRA waste number U-162; NCI-C-50680; MMA; 2-Methylpropenoic acid methyl ester; Methacrylic acid methyl ester; 2-Methyl-2-propenoic acid methyl ester; Methyl methacrylate monomer; 2-Methylpropenoic acid methyl; 2-Methylacrylic acid methyl; Methacrylic acid methyl; 2-Methylenepropanoic acid methyl)

Phenomenon after CH3OH (methanol) reacts with CH2=C(CH3)COOH (Methacrylic acid; alpha-Methylacrylic acid; 2-Methyl-2-propenoic acid; 2-Methylacrylic acid; 2-Methylpropenoic acid)

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance CH2=C(CH3)COOCH3 (Methyl methacrylate; Methyl isopropenoate; 2-Methyl-2-propenoic acid methyl; NA-1247; RCRA waste number U-162; NCI-C-50680; MMA; 2-Methylpropenoic acid methyl ester; Methacrylic acid methyl ester; 2-Methyl-2-propenoic acid methyl ester; Methyl methacrylate monomer; 2-Methylpropenoic acid methyl; 2-Methylacrylic acid methyl; Methacrylic acid methyl; 2-Methylenepropanoic acid methyl), appearing at the end of the reaction.

Or if any of the following reactant substances CH2=C(CH3)COOH (Methacrylic acid; alpha-Methylacrylic acid; 2-Methyl-2-propenoic acid; 2-Methylacrylic acid; 2-Methylpropenoic acid), disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions CH3OH + CH2=C(CH3)COOH → CH2=C(CH3)COOCH3

Questions related to reactant CH3OH (methanol)

What are the chemical and physical characteristic of CH3OH (methanol)? What are the chemical reactions that have CH3OH (methanol) as reactant?

Questions related to reactant CH2=C(CH3)COOH (Methacrylic acid; alpha-Methylacrylic acid; 2-Methyl-2-propenoic acid; 2-Methylacrylic acid; 2-Methylpropenoic acid)

What are the chemical and physical characteristic of CH2=C(CH3)COOH (Methacrylic acid; alpha-Methylacrylic acid; 2-Methyl-2-propenoic acid; 2-Methylacrylic acid; 2-Methylpropenoic acid)? What are the chemical reactions that have CH2=C(CH3)COOH (Methacrylic acid; alpha-Methylacrylic acid; 2-Methyl-2-propenoic acid; 2-Methylacrylic acid; 2-Methylpropenoic acid) as reactant?

Questions related to product CH2=C(CH3)COOCH3 (Methyl methacrylate; Methyl isopropenoate; 2-Methyl-2-propenoic acid methyl; NA-1247; RCRA waste number U-162; NCI-C-50680; MMA; 2-Methylpropenoic acid methyl ester; Methacrylic acid methyl ester; 2-Methyl-2-propenoic acid methyl ester; Methyl methacrylate monomer; 2-Methylpropenoic acid methyl; 2-Methylacrylic acid methyl; Methacrylic acid methyl; 2-Methylenepropanoic acid methyl)

What are the chemical and physical characteristic of CH2=C(CH3)COOCH3 (Methacrylic acid; alpha-Methylacrylic acid; 2-Methyl-2-propenoic acid; 2-Methylacrylic acid; 2-Methylpropenoic acid)? What are the chemical reactions that have CH2=C(CH3)COOCH3 (Methyl methacrylate; Methyl isopropenoate; 2-Methyl-2-propenoic acid methyl; NA-1247; RCRA waste number U-162; NCI-C-50680; MMA; 2-Methylpropenoic acid methyl ester; Methacrylic acid methyl ester; 2-Methyl-2-propenoic acid methyl ester; Methyl methacrylate monomer; 2-Methylpropenoic acid methyl; 2-Methylacrylic acid methyl; Methacrylic acid methyl; 2-Methylenepropanoic acid methyl) as product?

News Only 5% of POPULATION would know

Rating

CH3OH + CH2=C(CH3)COOH = CH2=C(CH3)COOCH3 | Chemical Equation

The total number of stars for this article is: 5 in 1 review
Rating: 5 / 5 stars

Equations with CH2=C(CH3)COOH as reactant

Methacrylic acid; alpha-Methylacrylic acid; 2-Methyl-2-propenoic acid; 2-Methylacrylic acid; 2-Methylpropenoic acid

CH3OH + CH2=C(CH3)COOH → CH2=C(CH3)COOCH3 NaOH + CH2=C(CH3)COOH → H2O + CH2=C(CH3)COONa View all equations with CH2=C(CH3)COOH as reactant
Advertisement

Equations with CH2=C(CH3)COOH as product

Methacrylic acid; alpha-Methylacrylic acid; 2-Methyl-2-propenoic acid; 2-Methylacrylic acid; 2-Methylpropenoic acid

View all equations with CH2=C(CH3)COOH as product
Advertisement

Breaking News

Interesting Information Only Few People Knows