Advertisement

CH3CH2CHO = tat-ca | Chemical Equation Balancer

Chemical equation search results

News Only 5% of POPULATION would know

Advertisement

Equation Result #1

CH3CH2CHOCH3-CH2-CH(OH)-CH2CH2CH2CH3
3-heptanol
(dd) (dd)
(không màu) (không màu)
1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Advertisement

Further information about equation CH3CH2CHO → CH3-CH2-CH(OH)-CH2CH2CH2CH3

What is reaction condition of CH3CH2CHO () ?

Other Condition: CH3(CH2)3MgBr

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce CH3-CH2-CH(OH)-CH2CH2CH2CH3 (3-heptanol) ?

Propanal reacts with CH3(CH2)3MgBr

Phenomenon after CH3CH2CHO ()

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance CH3-CH2-CH(OH)-CH2CH2CH2CH3 (3-heptanol), appearing at the end of the reaction.

Or if any of the following reactant substances CH3CH2CHO, disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions CH3CH2CHO → CH3-CH2-CH(OH)-CH2CH2CH2CH3

Questions related to reactant CH3CH2CHO ()

What are the chemical and physical characteristic of CH3CH2CHO ()? What are the chemical reactions that have CH3CH2CHO () as reactant?

Questions related to product CH3-CH2-CH(OH)-CH2CH2CH2CH3 (3-heptanol)

What are the chemical and physical characteristic of CH3-CH2-CH(OH)-CH2CH2CH2CH3 ()? What are the chemical reactions that have CH3-CH2-CH(OH)-CH2CH2CH2CH3 (3-heptanol) as product?
Advertisement

Equation Result #2

H2 + CH3CH2CHOCH3CH2CH2OH
hydrogen propan-1-ol
(khí) (lỏng) (lỏng)
(không màu) (không màu) (không màu)
1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Advertisement

Further information about equation H2 + CH3CH2CHO → CH3CH2CH2OH

What is reaction condition of H2 (hydrogen) reacts with CH3CH2CHO () ?

No information found for this chemical equation

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce CH3CH2CH2OH (propan-1-ol) ?

Phenomenon after H2 (hydrogen) reacts with CH3CH2CHO ()

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance CH3CH2CH2OH (propan-1-ol), appearing at the end of the reaction.

Or if any of the following reactant substances CH3CH2CHO, disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions H2 + CH3CH2CHO → CH3CH2CH2OH

Questions related to reactant H2 (hydrogen)

What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?

Questions related to reactant CH3CH2CHO ()

What are the chemical and physical characteristic of CH3CH2CHO ()? What are the chemical reactions that have CH3CH2CHO () as reactant?

Questions related to product CH3CH2CH2OH (propan-1-ol)

What are the chemical and physical characteristic of CH3CH2CH2OH ()? What are the chemical reactions that have CH3CH2CH2OH (propan-1-ol) as product?
Advertisement

Equation Result #3

O2 + 2CH3CH2CHO2CH3CH2COOH
oxygen propionic acid
1 2 2 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Advertisement

Further information about equation O2 + 2CH3CH2CHO → 2CH3CH2COOH

What is reaction condition of O2 (oxygen) reacts with CH3CH2CHO () ?

Temperature: temperature Solvent: Mn2+

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce CH3CH2COOH (propionic acid) ?

Phenomenon after O2 (oxygen) reacts with CH3CH2CHO ()

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance CH3CH2COOH (propionic acid), appearing at the end of the reaction.

Or if any of the following reactant substances CH3CH2CHO, disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions O2 + 2CH3CH2CHO → 2CH3CH2COOH

Questions related to reactant O2 (oxygen)

What are the chemical and physical characteristic of O2 (oxygen)? What are the chemical reactions that have O2 (oxygen) as reactant?

Questions related to reactant CH3CH2CHO ()

What are the chemical and physical characteristic of CH3CH2CHO ()? What are the chemical reactions that have CH3CH2CHO () as reactant?

Questions related to product CH3CH2COOH (propionic acid)

What are the chemical and physical characteristic of CH3CH2COOH ()? What are the chemical reactions that have CH3CH2COOH (propionic acid) as product?

Breaking News

Interesting Information Only Few People Knows


Income form ads help us maintain content with highest quality why we need to place adverts ? :D

I don't want to support website (close) - :(