Advertisement

H2 = ? | Chemical Equation Balancer

hydrogen = ?

News Only 5% of POPULATION would know

Advertisement

Equation Result #1

H2 + I22HI
hydrogen iodine hydroiodic acid
(khí) (rắn) (khí)
(không màu) (đen tím) (không màu)
1 1 2 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Advertisement

Further information about equation H2 + I2 → 2HI

What is reaction condition of H2 (hydrogen) reacts with I2 (iodine) ?

Temperature: 350 - 500°C Solvent: Pt

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce HI (hydroiodic acid) ?

H2 reacts with I2

Phenomenon after H2 (hydrogen) reacts with I2 (iodine)

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance HI (hydroiodic acid), appearing at the end of the reaction.

Or if any of the following reactant substances I2 (iodine), disappearing

What are other important informations you should know about reaction

Iodine can only oxidate hydrogen at high temperature and with catalyst to create hydrogen iodide gas

Categories of equation


Further questions related to chemical reactions H2 + I2 → 2HI

Questions related to reactant H2 (hydrogen)

What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?

Questions related to reactant I2 (iodine)

What are the chemical and physical characteristic of I2 (iodine)? What are the chemical reactions that have I2 (iodine) as reactant?

Questions related to product HI (hydroiodic acid)

What are the chemical and physical characteristic of HI (iodine)? What are the chemical reactions that have HI (hydroiodic acid) as product?
Advertisement

Equation Result #2

H2 + SH2S
hydrogen sulfur hydrogen sulfide
(khí) (rắn) (khí)
(không màu) (vàng chanh) (không màu)
1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Advertisement

Further information about equation H2 + S → H2S

What is reaction condition of H2 (hydrogen) reacts with S (sulfur) ?

Temperature: < 350

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce H2S (hydrogen sulfide) ?

H2 reacts with S

Phenomenon after H2 (hydrogen) reacts with S (sulfur)

Click to see equation's phenomenon

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions H2 + S → H2S

Questions related to reactant H2 (hydrogen)

What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?

Questions related to reactant S (sulfur)

What are the chemical and physical characteristic of S (sulfur)? What are the chemical reactions that have S (sulfur) as reactant?

Questions related to product H2S (hydrogen sulfide)

What are the chemical and physical characteristic of H2S (sulfur)? What are the chemical reactions that have H2S (hydrogen sulfide) as product?
Advertisement

Equation Result #3

H2 + CH3[CH2]7CH=CH[CH2]7COOCH3CH3[CH2]16COOCH3
hydrogen
(khí) (rắn) (rắn)
(không màu) (không màu) (không màu)
1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Advertisement

Further information about equation H2 + CH3[CH2]7CH=CH[CH2]7COOCH3 → CH3[CH2]16COOCH3

What is reaction condition of H2 (hydrogen) reacts with CH3[CH2]7CH=CH[CH2]7COOCH3 () ?

Temperature: high temperature Pressure: 1 Solvent: Ni

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce CH3[CH2]16COOCH3 () ?

Methyl oleate reacts with H2

Phenomenon after H2 (hydrogen) reacts with CH3[CH2]7CH=CH[CH2]7COOCH3 ()

Click to see equation's phenomenon

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions H2 + CH3[CH2]7CH=CH[CH2]7COOCH3 → CH3[CH2]16COOCH3

Questions related to reactant H2 (hydrogen)

What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?

Questions related to reactant CH3[CH2]7CH=CH[CH2]7COOCH3 ()

What are the chemical and physical characteristic of CH3[CH2]7CH=CH[CH2]7COOCH3 ()? What are the chemical reactions that have CH3[CH2]7CH=CH[CH2]7COOCH3 () as reactant?

Questions related to product CH3[CH2]16COOCH3 ()

What are the chemical and physical characteristic of CH3[CH2]16COOCH3 ()? What are the chemical reactions that have CH3[CH2]16COOCH3 () as product?

Equation Result #4

3H2 + N22NH3
hydrogen nitrogen ammonia
(khí) (khí) (khí)
(không màu) (không màu) (không màu, mùi khai)
3 1 2 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Further information about equation 3H2 + N2 → 2NH3

What is reaction condition of H2 (hydrogen) reacts with N2 (nitrogen) ?

Temperature: 500°C Pressure: pressure condition Solvent: Fe, Pt

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce NH3 (ammonia) ?

Phenomenon after H2 (hydrogen) reacts with N2 (nitrogen)

Click to see equation's phenomenon

What are other important informations you should know about reaction

The speed of this reaction is very slow at normal temperature. It is exothermal. The mol amount of the product is less than that of reacted substances. Therefore, they have to carry out this reaction at high temperature with high pressure and catalytic solution. At high pressure, balance moves to the direction of creating NH3, but at high temperature, balance moves opposite, so it is only carried out at appropriate temperature.

Categories of equation


Further questions related to chemical reactions 3H2 + N2 → 2NH3

Questions related to reactant H2 (hydrogen)

What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?

Questions related to reactant N2 (nitrogen)

What are the chemical and physical characteristic of N2 (nitrogen)? What are the chemical reactions that have N2 (nitrogen) as reactant?

Questions related to product NH3 (ammonia)

What are the chemical and physical characteristic of NH3 (nitrogen)? What are the chemical reactions that have NH3 (ammonia) as product?

Equation Result #5

C + 2H2CH4
carbon hydrogen methane
(rắn) (khí) (khí)
(không màu) (không màu)
1 2 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Further information about equation C + 2H2 → CH4

What is reaction condition of C (carbon) reacts with H2 (hydrogen) ?

Temperature: temperature Solvent: catalyze

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce CH4 (methane) ?

C reacts with H2 to form CH4 gas

Phenomenon after C (carbon) reacts with H2 (hydrogen)

Click to see equation's phenomenon

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions C + 2H2 → CH4

Questions related to reactant C (carbon)

What are the chemical and physical characteristic of C (carbon)? What are the chemical reactions that have C (carbon) as reactant?

Questions related to reactant H2 (hydrogen)

What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?

Questions related to product CH4 (methane)

What are the chemical and physical characteristic of CH4 (hydrogen)? What are the chemical reactions that have CH4 (methane) as product?

Breaking News

Interesting Information Only Few People Knows


Income form ads help us maintain content with highest quality why we need to place adverts ? :D

I don't want to support website (close) - :(