Equation Result #1
H2 | + | I2 | ↔ | 2HI | |
hydrogen | iodine | hydroiodic acid | |||
(khí) | (rắn) | (khí) | |||
(không màu) | (đen tím) | (không màu) | |||
1 | 1 | 2 | Hệ số | ||
Nguyên - Phân tử khối (g/mol) | |||||
Số mol | |||||
Khối lượng (g) |
Temperature: 350 - 500°C Solvent: Pt
Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.
H2 reacts with I2
This equation does not have any specific information about phenomenon.
In this case, you just need to observe to see if product substance HI (hydroiodic acid), appearing at the end of the reaction.
Or if any of the following reactant substances I2 (iodine), disappearing
Iodine can only oxidate hydrogen at high temperature and with catalyst to create hydrogen iodide gas
Equation Result #2
H2 | + | S | → | H2S | |
hydrogen | sulfur | hydrogen sulfide | |||
(khí) | (rắn) | (khí) | |||
(không màu) | (vàng chanh) | (không màu) | |||
1 | 1 | 1 | Hệ số | ||
Nguyên - Phân tử khối (g/mol) | |||||
Số mol | |||||
Khối lượng (g) |
Temperature: < 350
Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.
H2 reacts with S
We no further information about this chemical reactions.
Equation Result #3
H2 | + | CH3[CH2]7CH=CH[CH2]7COOCH3 | → | CH3[CH2]16COOCH3 | |
hydrogen | |||||
(khí) | (rắn) | (rắn) | |||
(không màu) | (không màu) | (không màu) | |||
1 | 1 | 1 | Hệ số | ||
Nguyên - Phân tử khối (g/mol) | |||||
Số mol | |||||
Khối lượng (g) |
Temperature: high temperature Pressure: 1 Solvent: Ni
Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.
Methyl oleate reacts with H2
We no further information about this chemical reactions.
Equation Result #4
3H2 | + | N2 | ↔ | 2NH3 | |
hydrogen | nitrogen | ammonia | |||
(khí) | (khí) | (khí) | |||
(không màu) | (không màu) | (không màu, mùi khai) | |||
3 | 1 | 2 | Hệ số | ||
Nguyên - Phân tử khối (g/mol) | |||||
Số mol | |||||
Khối lượng (g) |
Temperature: 500°C Pressure: pressure condition Solvent: Fe, Pt
Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.
The speed of this reaction is very slow at normal temperature. It is exothermal. The mol amount of the product is less than that of reacted substances. Therefore, they have to carry out this reaction at high temperature with high pressure and catalytic solution. At high pressure, balance moves to the direction of creating NH3, but at high temperature, balance moves opposite, so it is only carried out at appropriate temperature.
Equation Result #5
C | + | 2H2 | → | CH4 | |
carbon | hydrogen | methane | |||
(rắn) | (khí) | (khí) | |||
(không màu) | (không màu) | ||||
1 | 2 | 1 | Hệ số | ||
Nguyên - Phân tử khối (g/mol) | |||||
Số mol | |||||
Khối lượng (g) |
Temperature: temperature Solvent: catalyze
Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.
C reacts with H2 to form CH4 gas
We no further information about this chemical reactions.
Interesting Information Only Few People Knows
Income form ads help us maintain content with highest quality why we need to place adverts ? :D
I don't want to support website (close) - :(