H2 = ? | Chemical Equation Balancer
hydrogen = ?
News Only 5% of POPULATION would know
Equation Result #1
| H2 | + | I2 | ↔ | 2HI | |
| hydrogen | iodine | hydroiodic acid | |||
| (khí) | (rắn) | (khí) | |||
| (không màu) | (đen tím) | (không màu) | |||
| 1 | 1 | 2 | Hệ số | ||
| Nguyên - Phân tử khối (g/mol) | |||||
| Số mol | |||||
| Khối lượng (g) |
Further information about equation H2 + I2 → 2HI
What is reaction condition of H2 (hydrogen) reacts with I2 (iodine) ?
Temperature: 350 - 500°C Solvent: Pt
Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.
How reactions can happened and produce HI (hydroiodic acid) ?
H2 reacts with I2
Phenomenon after H2 (hydrogen) reacts with I2 (iodine)
This equation does not have any specific information about phenomenon.
In this case, you just need to observe to see if product substance HI (hydroiodic acid), appearing at the end of the reaction.
Or if any of the following reactant substances I2 (iodine), disappearing
What are other important informations you should know about reaction
Iodine can only oxidate hydrogen at high temperature and with catalyst to create hydrogen iodide gas
Categories of equation
Further questions related to chemical reactions H2 + I2 → 2HI
Questions related to reactant H2 (hydrogen)
What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?Questions related to reactant I2 (iodine)
What are the chemical and physical characteristic of I2 (iodine)? What are the chemical reactions that have I2 (iodine) as reactant?Questions related to product HI (hydroiodic acid)
What are the chemical and physical characteristic of HI (iodine)? What are the chemical reactions that have HI (hydroiodic acid) as product?Equation Result #2
| H2 | + | S | → | H2S | |
| hydrogen | sulfur | hydrogen sulfide | |||
| (khí) | (rắn) | (khí) | |||
| (không màu) | (vàng chanh) | (không màu) | |||
| 1 | 1 | 1 | Hệ số | ||
| Nguyên - Phân tử khối (g/mol) | |||||
| Số mol | |||||
| Khối lượng (g) |
Further information about equation H2 + S → H2S
What is reaction condition of H2 (hydrogen) reacts with S (sulfur) ?
Temperature: < 350
Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.
How reactions can happened and produce H2S (hydrogen sulfide) ?
H2 reacts with S
Phenomenon after H2 (hydrogen) reacts with S (sulfur)
Click to see equation's phenomenonWhat are other important informations you should know about reaction
We no further information about this chemical reactions.
Categories of equation
Further questions related to chemical reactions H2 + S → H2S
Questions related to reactant H2 (hydrogen)
What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?Questions related to reactant S (sulfur)
What are the chemical and physical characteristic of S (sulfur)? What are the chemical reactions that have S (sulfur) as reactant?Questions related to product H2S (hydrogen sulfide)
What are the chemical and physical characteristic of H2S (sulfur)? What are the chemical reactions that have H2S (hydrogen sulfide) as product?Equation Result #3
| H2 | + | CH3[CH2]7CH=CH[CH2]7COOCH3 | → | CH3[CH2]16COOCH3 | |
| hydrogen | |||||
| (khí) | (rắn) | (rắn) | |||
| (không màu) | (không màu) | (không màu) | |||
| 1 | 1 | 1 | Hệ số | ||
| Nguyên - Phân tử khối (g/mol) | |||||
| Số mol | |||||
| Khối lượng (g) |
Further information about equation H2 + CH3[CH2]7CH=CH[CH2]7COOCH3 → CH3[CH2]16COOCH3
What is reaction condition of H2 (hydrogen) reacts with CH3[CH2]7CH=CH[CH2]7COOCH3 () ?
Temperature: high temperature Pressure: 1 Solvent: Ni
Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.
How reactions can happened and produce CH3[CH2]16COOCH3 () ?
Methyl oleate reacts with H2
Phenomenon after H2 (hydrogen) reacts with CH3[CH2]7CH=CH[CH2]7COOCH3 ()
Click to see equation's phenomenonWhat are other important informations you should know about reaction
We no further information about this chemical reactions.
Categories of equation
Further questions related to chemical reactions H2 + CH3[CH2]7CH=CH[CH2]7COOCH3 → CH3[CH2]16COOCH3
Questions related to reactant H2 (hydrogen)
What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?Questions related to reactant CH3[CH2]7CH=CH[CH2]7COOCH3 ()
What are the chemical and physical characteristic of CH3[CH2]7CH=CH[CH2]7COOCH3 ()? What are the chemical reactions that have CH3[CH2]7CH=CH[CH2]7COOCH3 () as reactant?Questions related to product CH3[CH2]16COOCH3 ()
What are the chemical and physical characteristic of CH3[CH2]16COOCH3 ()? What are the chemical reactions that have CH3[CH2]16COOCH3 () as product?Equation Result #4
| 3H2 | + | N2 | ↔ | 2NH3 | |
| hydrogen | nitrogen | ammonia | |||
| (khí) | (khí) | (khí) | |||
| (không màu) | (không màu) | (không màu, mùi khai) | |||
| 3 | 1 | 2 | Hệ số | ||
| Nguyên - Phân tử khối (g/mol) | |||||
| Số mol | |||||
| Khối lượng (g) |
Further information about equation 3H2 + N2 → 2NH3
What is reaction condition of H2 (hydrogen) reacts with N2 (nitrogen) ?
Temperature: 500°C Pressure: pressure condition Solvent: Fe, Pt
Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.
How reactions can happened and produce NH3 (ammonia) ?
Phenomenon after H2 (hydrogen) reacts with N2 (nitrogen)
Click to see equation's phenomenonWhat are other important informations you should know about reaction
The speed of this reaction is very slow at normal temperature. It is exothermal. The mol amount of the product is less than that of reacted substances. Therefore, they have to carry out this reaction at high temperature with high pressure and catalytic solution. At high pressure, balance moves to the direction of creating NH3, but at high temperature, balance moves opposite, so it is only carried out at appropriate temperature.
Categories of equation
Further questions related to chemical reactions 3H2 + N2 → 2NH3
Questions related to reactant H2 (hydrogen)
What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?Questions related to reactant N2 (nitrogen)
What are the chemical and physical characteristic of N2 (nitrogen)? What are the chemical reactions that have N2 (nitrogen) as reactant?Questions related to product NH3 (ammonia)
What are the chemical and physical characteristic of NH3 (nitrogen)? What are the chemical reactions that have NH3 (ammonia) as product?Equation Result #5
| C | + | 2H2 | → | CH4 | |
| carbon | hydrogen | methane | |||
| (rắn) | (khí) | (khí) | |||
| (không màu) | (không màu) | ||||
| 1 | 2 | 1 | Hệ số | ||
| Nguyên - Phân tử khối (g/mol) | |||||
| Số mol | |||||
| Khối lượng (g) |
Further information about equation C + 2H2 → CH4
What is reaction condition of C (carbon) reacts with H2 (hydrogen) ?
Temperature: temperature Solvent: catalyze
Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.
How reactions can happened and produce CH4 (methane) ?
C reacts with H2 to form CH4 gas
Phenomenon after C (carbon) reacts with H2 (hydrogen)
Click to see equation's phenomenonWhat are other important informations you should know about reaction
We no further information about this chemical reactions.
Categories of equation
Further questions related to chemical reactions C + 2H2 → CH4
Questions related to reactant C (carbon)
What are the chemical and physical characteristic of C (carbon)? What are the chemical reactions that have C (carbon) as reactant?Questions related to reactant H2 (hydrogen)
What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?Questions related to product CH4 (methane)
What are the chemical and physical characteristic of CH4 (hydrogen)? What are the chemical reactions that have CH4 (methane) as product?
Breaking News
Interesting Information Only Few People Knows
Mobile Apps
|
|
Chemistry Tools
Periodic Table of Elements Solubility table Electron configuration Reactivity series Electrochemical seriesAbout Be Ready Education
Our SponsorsOther Education Software
Be Ready IELTS Dictionary of Physics Dictionary of Vietnamese Sign Language Library of Vietnamese History Creative Education Systems Cause and Effect Story Vietnamese Edu Book Online Sách Giáo Khoa Việt Nam Sách Việt Tại Úc Unicorn Bio Trường Học Lập Trình Trang Trí Nhà Tây Ninh
You can help us keeping this good work
This system is delivered to you by Vietnamese students and teachers who contribute relentlessly to keep content update and report missing information
Donating to our cause, you are not only help supporting this website going on, but also directly helping charity project in Vietnam building shcools in rural areas.
Income form ads help us maintain content with highest quality why we need to place adverts ? :D
I don't want to support website (close) - :(