CH3OH = ? | Chemical Equation Balancer

methanol = ?

Advertisement

Equation Result #1

CH3OH + C2H5COOHH2O + C2H5COOCH3
methanol Propanoic acid; Propionic acid; Ethylformic acid; Methylacetic acid; Prozoin; Propkorn; Propcorn; Adofeed; Luprosil; Ethanecarboxylic acid; Carboxyethane; Pseudoacetic acid; Metacetonic acid; Antischim B; MonoProp; Gumisan water Propanoic acid methyl; Propionic acid methyl; Propanoic acid methyl ester; Propionic acid methyl ester; Methyl propionate
(lỏng) (lỏng) (lỏng) (lỏng)
(không màu) (không màu) (không màu) (không màu)
1 1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Advertisement

Further information about equation CH3OH + C2H5COOH → H2O + C2H5COOCH3

What is reaction condition of CH3OH (methanol) reacts with C2H5COOH (Propanoic acid; Propionic acid; Ethylformic acid; Methylacetic acid; Prozoin; Propkorn; Propcorn; Adofeed; Luprosil; Ethanecarboxylic acid; Carboxyethane; Pseudoacetic acid; Metacetonic acid; Antischim B; MonoProp; Gumisan) ?

No information found for this chemical equation

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce H2O (water) and C2H5COOCH3 (Propanoic acid methyl; Propionic acid methyl; Propanoic acid methyl ester; Propionic acid methyl ester; Methyl propionate) ?

Methanol reacts with propionic acid

Phenomenon after CH3OH (methanol) reacts with C2H5COOH (Propanoic acid; Propionic acid; Ethylformic acid; Methylacetic acid; Prozoin; Propkorn; Propcorn; Adofeed; Luprosil; Ethanecarboxylic acid; Carboxyethane; Pseudoacetic acid; Metacetonic acid; Antischim B; MonoProp; Gumisan)

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance C2H5COOCH3 (Propanoic acid methyl; Propionic acid methyl; Propanoic acid methyl ester; Propionic acid methyl ester; Methyl propionate), appearing at the end of the reaction.

Or if any of the following reactant substances C2H5COOH (Propanoic acid; Propionic acid; Ethylformic acid; Methylacetic acid; Prozoin; Propkorn; Propcorn; Adofeed; Luprosil; Ethanecarboxylic acid; Carboxyethane; Pseudoacetic acid; Metacetonic acid; Antischim B; MonoProp; Gumisan), disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions CH3OH + C2H5COOH → H2O + C2H5COOCH3

Questions related to reactant CH3OH (methanol)

What are the chemical and physical characteristic of CH3OH (methanol)? What are the chemical reactions that have CH3OH (methanol) as reactant?

Questions related to reactant C2H5COOH (Propanoic acid; Propionic acid; Ethylformic acid; Methylacetic acid; Prozoin; Propkorn; Propcorn; Adofeed; Luprosil; Ethanecarboxylic acid; Carboxyethane; Pseudoacetic acid; Metacetonic acid; Antischim B; MonoProp; Gumisan)

What are the chemical and physical characteristic of C2H5COOH (Propanoic acid; Propionic acid; Ethylformic acid; Methylacetic acid; Prozoin; Propkorn; Propcorn; Adofeed; Luprosil; Ethanecarboxylic acid; Carboxyethane; Pseudoacetic acid; Metacetonic acid; Antischim B; MonoProp; Gumisan)? What are the chemical reactions that have C2H5COOH (Propanoic acid; Propionic acid; Ethylformic acid; Methylacetic acid; Prozoin; Propkorn; Propcorn; Adofeed; Luprosil; Ethanecarboxylic acid; Carboxyethane; Pseudoacetic acid; Metacetonic acid; Antischim B; MonoProp; Gumisan) as reactant?

Questions related to product H2O (water)

What are the chemical and physical characteristic of H2O (Propanoic acid; Propionic acid; Ethylformic acid; Methylacetic acid; Prozoin; Propkorn; Propcorn; Adofeed; Luprosil; Ethanecarboxylic acid; Carboxyethane; Pseudoacetic acid; Metacetonic acid; Antischim B; MonoProp; Gumisan)? What are the chemical reactions that have H2O (water) as product?

Questions related to product C2H5COOCH3 (Propanoic acid methyl; Propionic acid methyl; Propanoic acid methyl ester; Propionic acid methyl ester; Methyl propionate)

What are the chemical and physical characteristic of C2H5COOCH3 (Propanoic acid; Propionic acid; Ethylformic acid; Methylacetic acid; Prozoin; Propkorn; Propcorn; Adofeed; Luprosil; Ethanecarboxylic acid; Carboxyethane; Pseudoacetic acid; Metacetonic acid; Antischim B; MonoProp; Gumisan)? What are the chemical reactions that have C2H5COOCH3 (Propanoic acid methyl; Propionic acid methyl; Propanoic acid methyl ester; Propionic acid methyl ester; Methyl propionate) as product?

Equation Result #2

CH3OH + COCH3COOH
methanol carbon monoxide ethanoic acid
(lỏng) (khí) (lỏng)
(không màu) (không màu) (không màu)
1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Advertisement

Further information about equation CH3OH + CO → CH3COOH

What is reaction condition of CH3OH (methanol) reacts with CO (carbon monoxide) ?

Temperature: temperature

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce CH3COOH (ethanoic acid) ?

Phenomenon after CH3OH (methanol) reacts with CO (carbon monoxide)

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance CH3COOH (ethanoic acid), appearing at the end of the reaction.

Or if any of the following reactant substances CO (carbon monoxide), disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions CH3OH + CO → CH3COOH

Questions related to reactant CH3OH (methanol)

What are the chemical and physical characteristic of CH3OH (methanol)? What are the chemical reactions that have CH3OH (methanol) as reactant?

Questions related to reactant CO (carbon monoxide)

What are the chemical and physical characteristic of CO (carbon monoxide)? What are the chemical reactions that have CO (carbon monoxide) as reactant?

Questions related to product CH3COOH (ethanoic acid)

What are the chemical and physical characteristic of CH3COOH (carbon monoxide)? What are the chemical reactions that have CH3COOH (ethanoic acid) as product?

Equation Result #3

CH3OH + CH2=C(CH3)COOHCH2=C(CH3)COOCH3
methanol Methacrylic acid; alpha-Methylacrylic acid; 2-Methyl-2-propenoic acid; 2-Methylacrylic acid; 2-Methylpropenoic acid Methyl methacrylate; Methyl isopropenoate; 2-Methyl-2-propenoic acid methyl; NA-1247; RCRA waste number U-162; NCI-C-50680; MMA; 2-Methylpropenoic acid methyl ester; Methacrylic acid methyl ester; 2-Methyl-2-propenoic acid methyl ester; Methyl methacrylate monomer; 2-Methylpropenoic acid methyl; 2-Methylacrylic acid methyl; Methacrylic acid methyl; 2-Methylenepropanoic acid methyl
(dung dịch) (dung dịch) (rắn)
(không màu)
1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Advertisement

Further information about equation CH3OH + CH2=C(CH3)COOH → CH2=C(CH3)COOCH3

What is reaction condition of CH3OH (methanol) reacts with CH2=C(CH3)COOH (Methacrylic acid; alpha-Methylacrylic acid; 2-Methyl-2-propenoic acid; 2-Methylacrylic acid; 2-Methylpropenoic acid) ?

Temperature: t0 Solvent: H+

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce CH2=C(CH3)COOCH3 (Methyl methacrylate; Methyl isopropenoate; 2-Methyl-2-propenoic acid methyl; NA-1247; RCRA waste number U-162; NCI-C-50680; MMA; 2-Methylpropenoic acid methyl ester; Methacrylic acid methyl ester; 2-Methyl-2-propenoic acid methyl ester; Methyl methacrylate monomer; 2-Methylpropenoic acid methyl; 2-Methylacrylic acid methyl; Methacrylic acid methyl; 2-Methylenepropanoic acid methyl) ?

CH2=C(CH3)COOH reacts with NaOH

Phenomenon after CH3OH (methanol) reacts with CH2=C(CH3)COOH (Methacrylic acid; alpha-Methylacrylic acid; 2-Methyl-2-propenoic acid; 2-Methylacrylic acid; 2-Methylpropenoic acid)

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance CH2=C(CH3)COOCH3 (Methyl methacrylate; Methyl isopropenoate; 2-Methyl-2-propenoic acid methyl; NA-1247; RCRA waste number U-162; NCI-C-50680; MMA; 2-Methylpropenoic acid methyl ester; Methacrylic acid methyl ester; 2-Methyl-2-propenoic acid methyl ester; Methyl methacrylate monomer; 2-Methylpropenoic acid methyl; 2-Methylacrylic acid methyl; Methacrylic acid methyl; 2-Methylenepropanoic acid methyl), appearing at the end of the reaction.

Or if any of the following reactant substances CH2=C(CH3)COOH (Methacrylic acid; alpha-Methylacrylic acid; 2-Methyl-2-propenoic acid; 2-Methylacrylic acid; 2-Methylpropenoic acid), disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions CH3OH + CH2=C(CH3)COOH → CH2=C(CH3)COOCH3

Questions related to reactant CH3OH (methanol)

What are the chemical and physical characteristic of CH3OH (methanol)? What are the chemical reactions that have CH3OH (methanol) as reactant?

Questions related to reactant CH2=C(CH3)COOH (Methacrylic acid; alpha-Methylacrylic acid; 2-Methyl-2-propenoic acid; 2-Methylacrylic acid; 2-Methylpropenoic acid)

What are the chemical and physical characteristic of CH2=C(CH3)COOH (Methacrylic acid; alpha-Methylacrylic acid; 2-Methyl-2-propenoic acid; 2-Methylacrylic acid; 2-Methylpropenoic acid)? What are the chemical reactions that have CH2=C(CH3)COOH (Methacrylic acid; alpha-Methylacrylic acid; 2-Methyl-2-propenoic acid; 2-Methylacrylic acid; 2-Methylpropenoic acid) as reactant?

Questions related to product CH2=C(CH3)COOCH3 (Methyl methacrylate; Methyl isopropenoate; 2-Methyl-2-propenoic acid methyl; NA-1247; RCRA waste number U-162; NCI-C-50680; MMA; 2-Methylpropenoic acid methyl ester; Methacrylic acid methyl ester; 2-Methyl-2-propenoic acid methyl ester; Methyl methacrylate monomer; 2-Methylpropenoic acid methyl; 2-Methylacrylic acid methyl; Methacrylic acid methyl; 2-Methylenepropanoic acid methyl)

What are the chemical and physical characteristic of CH2=C(CH3)COOCH3 (Methacrylic acid; alpha-Methylacrylic acid; 2-Methyl-2-propenoic acid; 2-Methylacrylic acid; 2-Methylpropenoic acid)? What are the chemical reactions that have CH2=C(CH3)COOCH3 (Methyl methacrylate; Methyl isopropenoate; 2-Methyl-2-propenoic acid methyl; NA-1247; RCRA waste number U-162; NCI-C-50680; MMA; 2-Methylpropenoic acid methyl ester; Methacrylic acid methyl ester; 2-Methyl-2-propenoic acid methyl ester; Methyl methacrylate monomer; 2-Methylpropenoic acid methyl; 2-Methylacrylic acid methyl; Methacrylic acid methyl; 2-Methylenepropanoic acid methyl) as product?
Advertisement

Equation Result #4

C2H2 + CH3OHCH3OCHCH2
acetylene methanol Metoxyethylene; Methyl vinyl ether; Ethenyl(methyl) ether; Methylvinyl ether; (Methyl)vinyl ether; Ethenylmethyl ether; Vinyl(methyl) ether; Vinyl methyl ether; Methoxyethene; 1-Methoxyethene
(khí)
(không màu)
1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Further information about equation C2H2 + CH3OH → CH3OCHCH2

What is reaction condition of C2H2 (acetylene) reacts with CH3OH (methanol) ?

Temperature: 200°C Solvent: KOH

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce CH3OCHCH2 (Metoxyethylene; Methyl vinyl ether; Ethenyl(methyl) ether; Methylvinyl ether; (Methyl)vinyl ether; Ethenylmethyl ether; Vinyl(methyl) ether; Vinyl methyl ether; Methoxyethene; 1-Methoxyethene) ?

Phenomenon after C2H2 (acetylene) reacts with CH3OH (methanol)

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance CH3OCHCH2 (Metoxyethylene; Methyl vinyl ether; Ethenyl(methyl) ether; Methylvinyl ether; (Methyl)vinyl ether; Ethenylmethyl ether; Vinyl(methyl) ether; Vinyl methyl ether; Methoxyethene; 1-Methoxyethene), appearing at the end of the reaction.

Or if any of the following reactant substances CH3OH (methanol), disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions C2H2 + CH3OH → CH3OCHCH2

Questions related to reactant C2H2 (acetylene)

What are the chemical and physical characteristic of C2H2 (acetylene)? What are the chemical reactions that have C2H2 (acetylene) as reactant?

Questions related to reactant CH3OH (methanol)

What are the chemical and physical characteristic of CH3OH (methanol)? What are the chemical reactions that have CH3OH (methanol) as reactant?

Questions related to product CH3OCHCH2 (Metoxyethylene; Methyl vinyl ether; Ethenyl(methyl) ether; Methylvinyl ether; (Methyl)vinyl ether; Ethenylmethyl ether; Vinyl(methyl) ether; Vinyl methyl ether; Methoxyethene; 1-Methoxyethene)

What are the chemical and physical characteristic of CH3OCHCH2 (methanol)? What are the chemical reactions that have CH3OCHCH2 (Metoxyethylene; Methyl vinyl ether; Ethenyl(methyl) ether; Methylvinyl ether; (Methyl)vinyl ether; Ethenylmethyl ether; Vinyl(methyl) ether; Vinyl methyl ether; Methoxyethene; 1-Methoxyethene) as product?

Equation Result #5

2CH3OH + CH2(COOH)22H2O + CH2(COOCH3)2
methanol water
(lỏng) (lỏng) (lỏng)
(không màu) (không màu) (không màu)
2 1 2 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Further information about equation 2CH3OH + CH2(COOH)2 → 2H2O + CH2(COOCH3)2

What is reaction condition of CH3OH (methanol) reacts with CH2(COOH)2 () ?

No information found for this chemical equation

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce H2O (water) and CH2(COOCH3)2 () ?

CH2(COOH)2 reacts with methanol

Phenomenon after CH3OH (methanol) reacts with CH2(COOH)2 ()

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance CH2(COOCH3)2, appearing at the end of the reaction.

Or if any of the following reactant substances CH2(COOH)2, disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions 2CH3OH + CH2(COOH)2 → 2H2O + CH2(COOCH3)2

Questions related to reactant CH3OH (methanol)

What are the chemical and physical characteristic of CH3OH (methanol)? What are the chemical reactions that have CH3OH (methanol) as reactant?

Questions related to reactant CH2(COOH)2 ()

What are the chemical and physical characteristic of CH2(COOH)2 ()? What are the chemical reactions that have CH2(COOH)2 () as reactant?

Questions related to product H2O (water)

What are the chemical and physical characteristic of H2O ()? What are the chemical reactions that have H2O (water) as product?

Questions related to product CH2(COOCH3)2 ()

What are the chemical and physical characteristic of CH2(COOCH3)2 ()? What are the chemical reactions that have CH2(COOCH3)2 () as product?
Tin Tức Bạn Có Thể Thích
Advertisement

Breaking News

Interesting Information Only Few People Knows