Advertisement

CH2=CHCOO-CH3 = ? | Chemical Equation Balancer

Chemical equation search results

News Only 5% of POPULATION would know

Advertisement

Equation Result #1

nCH2=CHCOO-CH3(-CH2-CH(OOCH3)-)n
(rắn) (rắn)
n 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Advertisement

Further information about equation nCH2=CHCOO-CH3 → (-CH2-CH(OOCH3)-)n

What is reaction condition of CH2=CHCOO-CH3 () ?

Temperature: t0 Solvent: catalyze, p

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce (-CH2-CH(OOCH3)-)n () ?

Polymerization of methyl acrylate

Phenomenon after CH2=CHCOO-CH3 ()

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance (-CH2-CH(OOCH3)-)n, appearing at the end of the reaction.

Or if any of the following reactant substances CH2=CHCOO-CH3, disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions nCH2=CHCOO-CH3 → (-CH2-CH(OOCH3)-)n

Questions related to reactant CH2=CHCOO-CH3 ()

What are the chemical and physical characteristic of CH2=CHCOO-CH3 ()? What are the chemical reactions that have CH2=CHCOO-CH3 () as reactant?

Questions related to product (-CH2-CH(OOCH3)-)n ()

What are the chemical and physical characteristic of (-CH2-CH(OOCH3)-)n ()? What are the chemical reactions that have (-CH2-CH(OOCH3)-)n () as product?
Advertisement

Equation Result #2

NaOH + CH2=CHCOO-CH3CH3OH + CH2=CHCOONa
sodium hydroxide methanol
(dung dịch) (rắn) (lỏng) (rắn)
(không màu)
1 1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Advertisement

Further information about equation NaOH + CH2=CHCOO-CH3 → CH3OH + CH2=CHCOONa

What is reaction condition of NaOH (sodium hydroxide) reacts with CH2=CHCOO-CH3 () ?

No information found for this chemical equation

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce CH3OH (methanol) and CH2=CHCOONa () ?

Metyl acrylat reacts with NaOH

Phenomenon after NaOH (sodium hydroxide) reacts with CH2=CHCOO-CH3 ()

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance CH2=CHCOONa, appearing at the end of the reaction.

Or if any of the following reactant substances CH2=CHCOO-CH3, disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions NaOH + CH2=CHCOO-CH3 → CH3OH + CH2=CHCOONa

Questions related to reactant NaOH (sodium hydroxide)

What are the chemical and physical characteristic of NaOH (sodium hydroxide)? What are the chemical reactions that have NaOH (sodium hydroxide) as reactant?

Questions related to reactant CH2=CHCOO-CH3 ()

What are the chemical and physical characteristic of CH2=CHCOO-CH3 ()? What are the chemical reactions that have CH2=CHCOO-CH3 () as reactant?

Questions related to product CH3OH (methanol)

What are the chemical and physical characteristic of CH3OH ()? What are the chemical reactions that have CH3OH (methanol) as product?

Questions related to product CH2=CHCOONa ()

What are the chemical and physical characteristic of CH2=CHCOONa ()? What are the chemical reactions that have CH2=CHCOONa () as product?
Advertisement

Breaking News

Interesting Information Only Few People Knows


Income form ads help us maintain content with highest quality why we need to place adverts ? :D

I don't want to support website (close) - :(