Advertisement

C6H5COCH3 = ? | Chemical Equation Balancer

Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde = ?

News Only 5% of POPULATION would know

Advertisement

Equation Result #1

C6H5COCH3C6H5-C(NNHC6H5)-CH3
Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde Acetonephenone phenylhydrazone
(dd) (dd)
1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Advertisement

Further information about equation C6H5COCH3 → C6H5-C(NNHC6H5)-CH3

What is reaction condition of C6H5COCH3 (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde) ?

Other Condition: H2NNHC6H5

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce C6H5-C(NNHC6H5)-CH3 (Acetonephenone phenylhydrazone) ?

Acetophenone reacts with H2NNHC6H5

Phenomenon after C6H5COCH3 (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde)

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance C6H5-C(NNHC6H5)-CH3 (Acetonephenone phenylhydrazone), appearing at the end of the reaction.

Or if any of the following reactant substances C6H5COCH3 (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde), disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions C6H5COCH3 → C6H5-C(NNHC6H5)-CH3

Questions related to reactant C6H5COCH3 (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde)

What are the chemical and physical characteristic of C6H5COCH3 (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde)? What are the chemical reactions that have C6H5COCH3 (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde) as reactant?

Questions related to product C6H5-C(NNHC6H5)-CH3 (Acetonephenone phenylhydrazone)

What are the chemical and physical characteristic of C6H5-C(NNHC6H5)-CH3 (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde)? What are the chemical reactions that have C6H5-C(NNHC6H5)-CH3 (Acetonephenone phenylhydrazone) as product?
Advertisement

Equation Result #2

H2 + C6H5COCH3C6H5CH(CH3)OH
hydrogen Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde 1-Phenylethanol; Styrallyl alcohol; Methylphenylcarbinol; alpha-Hydroxyethylbenzene; alpha-Phenylethyl alcohol; alpha-Methylbenzyl alcohol; alpha-Methylbenzenemethanol; (alpha-Methylbenzyl) alcohol; 1-(Phenyl)ethanol; alpha-Methyl-4-benzenemethanol; 1-Phenylethan-1-ol; Benzene(alpha-methylmethanol)
1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Advertisement

Further information about equation H2 + C6H5COCH3 → C6H5CH(CH3)OH

What is reaction condition of H2 (hydrogen) reacts with C6H5COCH3 (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde) ?

Solvent: Pd

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce C6H5CH(CH3)OH (1-Phenylethanol; Styrallyl alcohol; Methylphenylcarbinol; alpha-Hydroxyethylbenzene; alpha-Phenylethyl alcohol; alpha-Methylbenzyl alcohol; alpha-Methylbenzenemethanol; (alpha-Methylbenzyl) alcohol; 1-(Phenyl)ethanol; alpha-Methyl-4-benzenemethanol; 1-Phenylethan-1-ol; Benzene(alpha-methylmethanol)) ?

Phenomenon after H2 (hydrogen) reacts with C6H5COCH3 (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde)

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance C6H5CH(CH3)OH (1-Phenylethanol; Styrallyl alcohol; Methylphenylcarbinol; alpha-Hydroxyethylbenzene; alpha-Phenylethyl alcohol; alpha-Methylbenzyl alcohol; alpha-Methylbenzenemethanol; (alpha-Methylbenzyl) alcohol; 1-(Phenyl)ethanol; alpha-Methyl-4-benzenemethanol; 1-Phenylethan-1-ol; Benzene(alpha-methylmethanol)), appearing at the end of the reaction.

Or if any of the following reactant substances C6H5COCH3 (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde), disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions H2 + C6H5COCH3 → C6H5CH(CH3)OH

Questions related to reactant H2 (hydrogen)

What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?

Questions related to reactant C6H5COCH3 (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde)

What are the chemical and physical characteristic of C6H5COCH3 (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde)? What are the chemical reactions that have C6H5COCH3 (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde) as reactant?

Questions related to product C6H5CH(CH3)OH (1-Phenylethanol; Styrallyl alcohol; Methylphenylcarbinol; alpha-Hydroxyethylbenzene; alpha-Phenylethyl alcohol; alpha-Methylbenzyl alcohol; alpha-Methylbenzenemethanol; (alpha-Methylbenzyl) alcohol; 1-(Phenyl)ethanol; alpha-Methyl-4-benzenemethanol; 1-Phenylethan-1-ol; Benzene(alpha-methylmethanol))

What are the chemical and physical characteristic of C6H5CH(CH3)OH (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde)? What are the chemical reactions that have C6H5CH(CH3)OH (1-Phenylethanol; Styrallyl alcohol; Methylphenylcarbinol; alpha-Hydroxyethylbenzene; alpha-Phenylethyl alcohol; alpha-Methylbenzyl alcohol; alpha-Methylbenzenemethanol; (alpha-Methylbenzyl) alcohol; 1-(Phenyl)ethanol; alpha-Methyl-4-benzenemethanol; 1-Phenylethan-1-ol; Benzene(alpha-methylmethanol)) as product?
Advertisement

Equation Result #3

H2 + C6H5COCH3C6H5CHOHCH3
hydrogen Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde DL-alpha-Phenylethyl alcohol; (+-)-alpha-Methylbenzyl alcohol; (+-)-Methylphenylcarbinol; (+-)-1-Phenylethanol; DL-1-Phenylethanol; DL-Styralyl alcohol; rac-(alphaR*)-alpha-Methylbenzenemethanol; rac-(alphaS*)-alpha-Methylbenzenemethanol
1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Advertisement

Further information about equation H2 + C6H5COCH3 → C6H5CHOHCH3

What is reaction condition of H2 (hydrogen) reacts with C6H5COCH3 (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde) ?

Solvent: Pd

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce C6H5CHOHCH3 (DL-alpha-Phenylethyl alcohol; (+-)-alpha-Methylbenzyl alcohol; (+-)-Methylphenylcarbinol; (+-)-1-Phenylethanol; DL-1-Phenylethanol; DL-Styralyl alcohol; rac-(alphaR*)-alpha-Methylbenzenemethanol; rac-(alphaS*)-alpha-Methylbenzenemethanol) ?

Phenomenon after H2 (hydrogen) reacts with C6H5COCH3 (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde)

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance C6H5CHOHCH3 (DL-alpha-Phenylethyl alcohol; (+-)-alpha-Methylbenzyl alcohol; (+-)-Methylphenylcarbinol; (+-)-1-Phenylethanol; DL-1-Phenylethanol; DL-Styralyl alcohol; rac-(alphaR*)-alpha-Methylbenzenemethanol; rac-(alphaS*)-alpha-Methylbenzenemethanol), appearing at the end of the reaction.

Or if any of the following reactant substances C6H5COCH3 (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde), disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions H2 + C6H5COCH3 → C6H5CHOHCH3

Questions related to reactant H2 (hydrogen)

What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?

Questions related to reactant C6H5COCH3 (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde)

What are the chemical and physical characteristic of C6H5COCH3 (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde)? What are the chemical reactions that have C6H5COCH3 (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde) as reactant?

Questions related to product C6H5CHOHCH3 (DL-alpha-Phenylethyl alcohol; (+-)-alpha-Methylbenzyl alcohol; (+-)-Methylphenylcarbinol; (+-)-1-Phenylethanol; DL-1-Phenylethanol; DL-Styralyl alcohol; rac-(alphaR*)-alpha-Methylbenzenemethanol; rac-(alphaS*)-alpha-Methylbenzenemethanol)

What are the chemical and physical characteristic of C6H5CHOHCH3 (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde)? What are the chemical reactions that have C6H5CHOHCH3 (DL-alpha-Phenylethyl alcohol; (+-)-alpha-Methylbenzyl alcohol; (+-)-Methylphenylcarbinol; (+-)-1-Phenylethanol; DL-1-Phenylethanol; DL-Styralyl alcohol; rac-(alphaR*)-alpha-Methylbenzenemethanol; rac-(alphaS*)-alpha-Methylbenzenemethanol) as product?

Equation Result #4

C6H5COCH3 + CH3COOOHCH3COOH + C6H5COOCH3
Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde Carboxymethane; Acetic acid; Ethanoic acid; Vinegar acid; Glacial acetic acid; Alas; Dandelion-Getter; Eco-N-Select; E-308-b ethanoic acid Benzoic acid methyl; Oxidate LE; Oil of Niobe; Niobe oil; Essence of Niobe; Methyl benzoate; Benzoic acid methyl ester; Benzenecarboxylic acid methyl ester; Benzenecarboxylic acid methyl
1 1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Further information about equation C6H5COCH3 + CH3COOOH → CH3COOH + C6H5COOCH3

What is reaction condition of C6H5COCH3 (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde) reacts with CH3COOOH (Carboxymethane; Acetic acid; Ethanoic acid; Vinegar acid; Glacial acetic acid; Alas; Dandelion-Getter; Eco-N-Select; E-308-b) ?

No information found for this chemical equation

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce CH3COOH (ethanoic acid) and C6H5COOCH3 (Benzoic acid methyl; Oxidate LE; Oil of Niobe; Niobe oil; Essence of Niobe; Methyl benzoate; Benzoic acid methyl ester; Benzenecarboxylic acid methyl ester; Benzenecarboxylic acid methyl) ?

Phenomenon after C6H5COCH3 (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde) reacts with CH3COOOH (Carboxymethane; Acetic acid; Ethanoic acid; Vinegar acid; Glacial acetic acid; Alas; Dandelion-Getter; Eco-N-Select; E-308-b)

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance C6H5COOCH3 (Benzoic acid methyl; Oxidate LE; Oil of Niobe; Niobe oil; Essence of Niobe; Methyl benzoate; Benzoic acid methyl ester; Benzenecarboxylic acid methyl ester; Benzenecarboxylic acid methyl), appearing at the end of the reaction.

Or if any of the following reactant substances CH3COOOH (Carboxymethane; Acetic acid; Ethanoic acid; Vinegar acid; Glacial acetic acid; Alas; Dandelion-Getter; Eco-N-Select; E-308-b), disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions C6H5COCH3 + CH3COOOH → CH3COOH + C6H5COOCH3

Questions related to reactant C6H5COCH3 (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde)

What are the chemical and physical characteristic of C6H5COCH3 (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde)? What are the chemical reactions that have C6H5COCH3 (Hypnone; Acetophenone; Acetylbenzene; 1-Phenylethanone; Methyl phenyl ketone; RCRA waste number U-004; USAF EK-496; Methyl (phenyl) ketone; Phenyl methyl ketone; 1-Phenylacetaldehyde; Phenyl (methyl) ketone; 1-(Phenyl)ethanone; 4-Acetylbenzene; 1-Acetylbenzene; 3-Acetylbenzene; 1-Phenylethan-1-one; alpha-Methylbenzaldehyde) as reactant?

Questions related to reactant CH3COOOH (Carboxymethane; Acetic acid; Ethanoic acid; Vinegar acid; Glacial acetic acid; Alas; Dandelion-Getter; Eco-N-Select; E-308-b)

What are the chemical and physical characteristic of CH3COOOH (Carboxymethane; Acetic acid; Ethanoic acid; Vinegar acid; Glacial acetic acid; Alas; Dandelion-Getter; Eco-N-Select; E-308-b)? What are the chemical reactions that have CH3COOOH (Carboxymethane; Acetic acid; Ethanoic acid; Vinegar acid; Glacial acetic acid; Alas; Dandelion-Getter; Eco-N-Select; E-308-b) as reactant?

Questions related to product CH3COOH (ethanoic acid)

What are the chemical and physical characteristic of CH3COOH (Carboxymethane; Acetic acid; Ethanoic acid; Vinegar acid; Glacial acetic acid; Alas; Dandelion-Getter; Eco-N-Select; E-308-b)? What are the chemical reactions that have CH3COOH (ethanoic acid) as product?

Questions related to product C6H5COOCH3 (Benzoic acid methyl; Oxidate LE; Oil of Niobe; Niobe oil; Essence of Niobe; Methyl benzoate; Benzoic acid methyl ester; Benzenecarboxylic acid methyl ester; Benzenecarboxylic acid methyl)

What are the chemical and physical characteristic of C6H5COOCH3 (Carboxymethane; Acetic acid; Ethanoic acid; Vinegar acid; Glacial acetic acid; Alas; Dandelion-Getter; Eco-N-Select; E-308-b)? What are the chemical reactions that have C6H5COOCH3 (Benzoic acid methyl; Oxidate LE; Oil of Niobe; Niobe oil; Essence of Niobe; Methyl benzoate; Benzoic acid methyl ester; Benzenecarboxylic acid methyl ester; Benzenecarboxylic acid methyl) as product?

Breaking News

Interesting Information Only Few People Knows


Income form ads help us maintain content with highest quality why we need to place adverts ? :D

I don't want to support website (close) - :(