Advertisement

CH3CH2CHO = CH3-CH2-CH(OH)-CH2CH2CH2CH3 | Chemical Equation Balancer

= 3-heptanol

News Only 5% of POPULATION would know

Advertisement

Equation Result #1

CH3CH2CHOCH3-CH2-CH(OH)-CH2CH2CH2CH3
3-heptanol
(dd) (dd)
(không màu) (không màu)
1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Advertisement

Further information about equation CH3CH2CHO → CH3-CH2-CH(OH)-CH2CH2CH2CH3

What is reaction condition of CH3CH2CHO () ?

Other Condition: CH3(CH2)3MgBr

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce CH3-CH2-CH(OH)-CH2CH2CH2CH3 (3-heptanol) ?

Propanal reacts with CH3(CH2)3MgBr

Phenomenon after CH3CH2CHO ()

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance CH3-CH2-CH(OH)-CH2CH2CH2CH3 (3-heptanol), appearing at the end of the reaction.

Or if any of the following reactant substances CH3CH2CHO, disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions CH3CH2CHO → CH3-CH2-CH(OH)-CH2CH2CH2CH3

Questions related to reactant CH3CH2CHO ()

What are the chemical and physical characteristic of CH3CH2CHO ()? What are the chemical reactions that have CH3CH2CHO () as reactant?

Questions related to product CH3-CH2-CH(OH)-CH2CH2CH2CH3 (3-heptanol)

What are the chemical and physical characteristic of CH3-CH2-CH(OH)-CH2CH2CH2CH3 ()? What are the chemical reactions that have CH3-CH2-CH(OH)-CH2CH2CH2CH3 (3-heptanol) as product?
Advertisement

Extra information about substances that equation use

produce CH3-CH2-CH(OH)-CH2CH2CH2CH3 (3-heptanol)

Reaction that produces substance CH3CH2CHO (Propanal) ()

NaOH + HCOOCH=CH-CH3 → HCOONa + CH3CH2CHO CH3COOC2H5 → C2H5OH + CH3CH2CHO CuO + CH3CH2CH2OH → Cu + H2O + CH3CH2CHO

Reaction that produces substance CH3-CH2-CH(OH)-CH2CH2CH2CH3 (3-heptanol) (3-heptanol)

CH3CH2CHO → CH3-CH2-CH(OH)-CH2CH2CH2CH3

Breaking News

Interesting Information Only Few People Knows


Income form ads help us maintain content with highest quality why we need to place adverts ? :D

I don't want to support website (close) - :(