H2 = ? | Chemical Equation Balancer
hydrogen = ?
News Only 5% of POPULATION would know
Equation Result #1
| 4H2 | + | Fe3O4 | → | 3Fe | + | 4H2O | |
| hydrogen | iron(ii,iii) oxide | iron | water | ||||
| (khí) | (rắn) | (rắn) | (lỏng) | ||||
| (không màu) | (nâu đen) | (trắng xám) | (không màu) | ||||
| 4 | 1 | 3 | 4 | Hệ số | |||
| Nguyên - Phân tử khối (g/mol) | |||||||
| Số mol | |||||||
| Khối lượng (g) |
Further information about equation 4H2 + Fe3O4 → 3Fe + 4H2O
What is reaction condition of H2 (hydrogen) reacts with Fe3O4 (iron(ii,iii) oxide) ?
Temperature: > 570
Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.
How reactions can happened and produce Fe (iron) and H2O (water) ?
Fe3O4 reacts with H2 in high temperature
Phenomenon after H2 (hydrogen) reacts with Fe3O4 (iron(ii,iii) oxide)
This equation does not have any specific information about phenomenon.
In this case, you just need to observe to see if product substance H2O (water), appearing at the end of the reaction.
Or if any of the following reactant substances Fe3O4 (iron(ii,iii) oxide), disappearing
What are other important informations you should know about reaction
We no further information about this chemical reactions.
Categories of equation
Further questions related to chemical reactions 4H2 + Fe3O4 → 3Fe + 4H2O
Questions related to reactant H2 (hydrogen)
What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?Questions related to reactant Fe3O4 (iron(ii,iii) oxide)
What are the chemical and physical characteristic of Fe3O4 (iron(ii,iii) oxide)? What are the chemical reactions that have Fe3O4 (iron(ii,iii) oxide) as reactant?Questions related to product Fe (iron)
What are the chemical and physical characteristic of Fe (iron(ii,iii) oxide)? What are the chemical reactions that have Fe (iron) as product?Questions related to product H2O (water)
What are the chemical and physical characteristic of H2O (iron(ii,iii) oxide)? What are the chemical reactions that have H2O (water) as product?Equation Result #2
| CO | + | 2H2 | → | CH3OH | |
| carbon monoxide | hydrogen | methanol | |||
| (khí) | (khí) | (lỏng) | |||
| 1 | 2 | 1 | Hệ số | ||
| Nguyên - Phân tử khối (g/mol) | |||||
| Số mol | |||||
| Khối lượng (g) |
Further information about equation CO + 2H2 → CH3OH
What is reaction condition of CO (carbon monoxide) reacts with H2 (hydrogen) ?
Temperature: 250 - 300°C Pressure: 300 Solvent: CuO/Cr2O3
Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.
How reactions can happened and produce CH3OH (methanol) ?
Phenomenon after CO (carbon monoxide) reacts with H2 (hydrogen)
This equation does not have any specific information about phenomenon.
In this case, you just need to observe to see if product substance CH3OH (methanol), appearing at the end of the reaction.
Or if any of the following reactant substances H2 (hydrogen), disappearing
What are other important informations you should know about reaction
We no further information about this chemical reactions.
Categories of equation
Further questions related to chemical reactions CO + 2H2 → CH3OH
Questions related to reactant CO (carbon monoxide)
What are the chemical and physical characteristic of CO (carbon monoxide)? What are the chemical reactions that have CO (carbon monoxide) as reactant?Questions related to reactant H2 (hydrogen)
What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?Questions related to product CH3OH (methanol)
What are the chemical and physical characteristic of CH3OH (hydrogen)? What are the chemical reactions that have CH3OH (methanol) as product?Equation Result #3
| C6H12O6 | + | H2 | → | C6H14O6 | |
| fructose | hydrogen | D-Glucit; D-Sorbit; D-Glucitol; D-Sorbitol; Sobitol; D-gluco-Hexitol; D-Sorbitol syrup; Glucitol; Sorbitol; Glucositol; Uromatic S; (2S,3R,4R,5R)-1,2,3,4,5,6-Hexanehexaol; Sorbo; Nivitin | |||
| (rắn) | (khí) | (rắn) | |||
| (trắng) | (không màu) | ||||
| 1 | 1 | 1 | Hệ số | ||
| Nguyên - Phân tử khối (g/mol) | |||||
| Số mol | |||||
| Khối lượng (g) |
Further information about equation C6H12O6 + H2 → C6H14O6
What is reaction condition of C6H12O6 (fructose) reacts with H2 (hydrogen) ?
Temperature: t0 Solvent: Ni
Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.
How reactions can happened and produce C6H14O6 (D-Glucit; D-Sorbit; D-Glucitol; D-Sorbitol; Sobitol; D-gluco-Hexitol; D-Sorbitol syrup; Glucitol; Sorbitol; Glucositol; Uromatic S; (2S,3R,4R,5R)-1,2,3,4,5,6-Hexanehexaol; Sorbo; Nivitin) ?
Hydrogenation of glucose
Phenomenon after C6H12O6 (fructose) reacts with H2 (hydrogen)
This equation does not have any specific information about phenomenon.
In this case, you just need to observe to see if product substance C6H14O6 (D-Glucit; D-Sorbit; D-Glucitol; D-Sorbitol; Sobitol; D-gluco-Hexitol; D-Sorbitol syrup; Glucitol; Sorbitol; Glucositol; Uromatic S; (2S,3R,4R,5R)-1,2,3,4,5,6-Hexanehexaol; Sorbo; Nivitin), appearing at the end of the reaction.
Or if any of the following reactant substances H2 (hydrogen), disappearing
What are other important informations you should know about reaction
We no further information about this chemical reactions.
Categories of equation
Further questions related to chemical reactions C6H12O6 + H2 → C6H14O6
Questions related to reactant C6H12O6 (fructose)
What are the chemical and physical characteristic of C6H12O6 (fructose)? What are the chemical reactions that have C6H12O6 (fructose) as reactant?Questions related to reactant H2 (hydrogen)
What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?Questions related to product C6H14O6 (D-Glucit; D-Sorbit; D-Glucitol; D-Sorbitol; Sobitol; D-gluco-Hexitol; D-Sorbitol syrup; Glucitol; Sorbitol; Glucositol; Uromatic S; (2S,3R,4R,5R)-1,2,3,4,5,6-Hexanehexaol; Sorbo; Nivitin)
What are the chemical and physical characteristic of C6H14O6 (hydrogen)? What are the chemical reactions that have C6H14O6 (D-Glucit; D-Sorbit; D-Glucitol; D-Sorbitol; Sobitol; D-gluco-Hexitol; D-Sorbitol syrup; Glucitol; Sorbitol; Glucositol; Uromatic S; (2S,3R,4R,5R)-1,2,3,4,5,6-Hexanehexaol; Sorbo; Nivitin) as product?Equation Result #4
| H2 | + | CH3(CH2)7CH=CH(CH2)7CO2CH3 | → | CH3(CH2)16CO2CH3 | |
| hydrogen | Methyl oleate | Methyl stearate | |||
| 1 | 1 | 1 | Hệ số | ||
| Nguyên - Phân tử khối (g/mol) | |||||
| Số mol | |||||
| Khối lượng (g) |
Further information about equation H2 + CH3(CH2)7CH=CH(CH2)7CO2CH3 → CH3(CH2)16CO2CH3
What is reaction condition of H2 (hydrogen) reacts with CH3(CH2)7CH=CH(CH2)7CO2CH3 (Methyl oleate) ?
Temperature: temperature Solvent: Ni
Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.
How reactions can happened and produce CH3(CH2)16CO2CH3 (Methyl stearate) ?
Phenomenon after H2 (hydrogen) reacts with CH3(CH2)7CH=CH(CH2)7CO2CH3 (Methyl oleate)
This equation does not have any specific information about phenomenon.
In this case, you just need to observe to see if product substance CH3(CH2)16CO2CH3 (Methyl stearate), appearing at the end of the reaction.
Or if any of the following reactant substances CH3(CH2)7CH=CH(CH2)7CO2CH3 (Methyl oleate), disappearing
What are other important informations you should know about reaction
We no further information about this chemical reactions.
Categories of equation
Further questions related to chemical reactions H2 + CH3(CH2)7CH=CH(CH2)7CO2CH3 → CH3(CH2)16CO2CH3
Questions related to reactant H2 (hydrogen)
What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?Questions related to reactant CH3(CH2)7CH=CH(CH2)7CO2CH3 (Methyl oleate)
What are the chemical and physical characteristic of CH3(CH2)7CH=CH(CH2)7CO2CH3 (Methyl oleate)? What are the chemical reactions that have CH3(CH2)7CH=CH(CH2)7CO2CH3 (Methyl oleate) as reactant?Questions related to product CH3(CH2)16CO2CH3 (Methyl stearate)
What are the chemical and physical characteristic of CH3(CH2)16CO2CH3 (Methyl oleate)? What are the chemical reactions that have CH3(CH2)16CO2CH3 (Methyl stearate) as product?Equation Result #5
| H2 | + | 2K | → | 2KH | |
| hydrogen | potassium | Potassium hydride; Hydrogen potassium salt | |||
| (khí) | (rắn) | (rắn) | |||
| (không màu) | (trắng bạc) | ||||
| 1 | 2 | 2 | Hệ số | ||
| Nguyên - Phân tử khối (g/mol) | |||||
| Số mol | |||||
| Khối lượng (g) |
Further information about equation H2 + 2K → 2KH
What is reaction condition of H2 (hydrogen) reacts with K (potassium) ?
Temperature: 200 - 350°C
Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.
How reactions can happened and produce KH (Potassium hydride; Hydrogen potassium salt) ?
H2 reacts with K
Phenomenon after H2 (hydrogen) reacts with K (potassium)
This equation does not have any specific information about phenomenon.
In this case, you just need to observe to see if product substance KH (Potassium hydride; Hydrogen potassium salt), appearing at the end of the reaction.
Or if any of the following reactant substances K (potassium), disappearing
What are other important informations you should know about reaction
We no further information about this chemical reactions.
Categories of equation
Further questions related to chemical reactions H2 + 2K → 2KH
Questions related to reactant H2 (hydrogen)
What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?Questions related to reactant K (potassium)
What are the chemical and physical characteristic of K (potassium)? What are the chemical reactions that have K (potassium) as reactant?Questions related to product KH (Potassium hydride; Hydrogen potassium salt)
What are the chemical and physical characteristic of KH (potassium)? What are the chemical reactions that have KH (Potassium hydride; Hydrogen potassium salt) as product?
Breaking News
Interesting Information Only Few People Knows
Mobile Apps
|
|
Chemistry Tools
Periodic Table of Elements Solubility table Electron configuration Reactivity series Electrochemical seriesAbout Be Ready Education
Our SponsorsOther Education Software
Dictionary of Physics Dictionary of Vietnamese Sign Language Creative Education Systems Vietnamese Edu Book Online Sách Giáo Khoa Việt Nam Sách Việt Tại Úc Unicorn Bioinlin
You can help us keeping this good work
This system is delivered to you by Vietnamese students and teachers who contribute relentlessly to keep content update and report missing information
Donating to our cause, you are not only help supporting this website going on, but also directly helping charity project in Vietnam building shcools in rural areas.