Advertisement

H2 = ? | Chemical Equation Balancer

hydrogen = ?

News Only 5% of POPULATION would know

Advertisement

Equation Result #1

4H2 + Fe3O43Fe + 4H2O
hydrogen iron(ii,iii) oxide iron water
(khí) (rắn) (rắn) (lỏng)
(không màu) (nâu đen) (trắng xám) (không màu)
4 1 3 4 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Advertisement

Further information about equation 4H2 + Fe3O4 → 3Fe + 4H2O

What is reaction condition of H2 (hydrogen) reacts with Fe3O4 (iron(ii,iii) oxide) ?

Temperature: > 570

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce Fe (iron) and H2O (water) ?

Fe3O4 reacts with H2 in high temperature

Phenomenon after H2 (hydrogen) reacts with Fe3O4 (iron(ii,iii) oxide)

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance H2O (water), appearing at the end of the reaction.

Or if any of the following reactant substances Fe3O4 (iron(ii,iii) oxide), disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions 4H2 + Fe3O4 → 3Fe + 4H2O

Questions related to reactant H2 (hydrogen)

What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?

Questions related to reactant Fe3O4 (iron(ii,iii) oxide)

What are the chemical and physical characteristic of Fe3O4 (iron(ii,iii) oxide)? What are the chemical reactions that have Fe3O4 (iron(ii,iii) oxide) as reactant?

Questions related to product Fe (iron)

What are the chemical and physical characteristic of Fe (iron(ii,iii) oxide)? What are the chemical reactions that have Fe (iron) as product?

Questions related to product H2O (water)

What are the chemical and physical characteristic of H2O (iron(ii,iii) oxide)? What are the chemical reactions that have H2O (water) as product?
Advertisement

Equation Result #2

CO + 2H2CH3OH
carbon monoxide hydrogen methanol
(khí) (khí) (lỏng)
1 2 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Advertisement

Further information about equation CO + 2H2 → CH3OH

What is reaction condition of CO (carbon monoxide) reacts with H2 (hydrogen) ?

Temperature: 250 - 300°C Pressure: 300 Solvent: CuO/Cr2O3

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce CH3OH (methanol) ?

Phenomenon after CO (carbon monoxide) reacts with H2 (hydrogen)

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance CH3OH (methanol), appearing at the end of the reaction.

Or if any of the following reactant substances H2 (hydrogen), disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions CO + 2H2 → CH3OH

Questions related to reactant CO (carbon monoxide)

What are the chemical and physical characteristic of CO (carbon monoxide)? What are the chemical reactions that have CO (carbon monoxide) as reactant?

Questions related to reactant H2 (hydrogen)

What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?

Questions related to product CH3OH (methanol)

What are the chemical and physical characteristic of CH3OH (hydrogen)? What are the chemical reactions that have CH3OH (methanol) as product?
Advertisement

Equation Result #3

C6H12O6 + H2C6H14O6
fructose hydrogen D-Glucit; D-Sorbit; D-Glucitol; D-Sorbitol; Sobitol; D-gluco-Hexitol; D-Sorbitol syrup; Glucitol; Sorbitol; Glucositol; Uromatic S; (2S,3R,4R,5R)-1,2,3,4,5,6-Hexanehexaol; Sorbo; Nivitin
(rắn) (khí) (rắn)
(trắng) (không màu)
1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Advertisement

Further information about equation C6H12O6 + H2 → C6H14O6

What is reaction condition of C6H12O6 (fructose) reacts with H2 (hydrogen) ?

Temperature: t0 Solvent: Ni

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce C6H14O6 (D-Glucit; D-Sorbit; D-Glucitol; D-Sorbitol; Sobitol; D-gluco-Hexitol; D-Sorbitol syrup; Glucitol; Sorbitol; Glucositol; Uromatic S; (2S,3R,4R,5R)-1,2,3,4,5,6-Hexanehexaol; Sorbo; Nivitin) ?

Hydrogenation of glucose

Phenomenon after C6H12O6 (fructose) reacts with H2 (hydrogen)

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance C6H14O6 (D-Glucit; D-Sorbit; D-Glucitol; D-Sorbitol; Sobitol; D-gluco-Hexitol; D-Sorbitol syrup; Glucitol; Sorbitol; Glucositol; Uromatic S; (2S,3R,4R,5R)-1,2,3,4,5,6-Hexanehexaol; Sorbo; Nivitin), appearing at the end of the reaction.

Or if any of the following reactant substances H2 (hydrogen), disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions C6H12O6 + H2 → C6H14O6

Questions related to reactant C6H12O6 (fructose)

What are the chemical and physical characteristic of C6H12O6 (fructose)? What are the chemical reactions that have C6H12O6 (fructose) as reactant?

Questions related to reactant H2 (hydrogen)

What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?

Questions related to product C6H14O6 (D-Glucit; D-Sorbit; D-Glucitol; D-Sorbitol; Sobitol; D-gluco-Hexitol; D-Sorbitol syrup; Glucitol; Sorbitol; Glucositol; Uromatic S; (2S,3R,4R,5R)-1,2,3,4,5,6-Hexanehexaol; Sorbo; Nivitin)

What are the chemical and physical characteristic of C6H14O6 (hydrogen)? What are the chemical reactions that have C6H14O6 (D-Glucit; D-Sorbit; D-Glucitol; D-Sorbitol; Sobitol; D-gluco-Hexitol; D-Sorbitol syrup; Glucitol; Sorbitol; Glucositol; Uromatic S; (2S,3R,4R,5R)-1,2,3,4,5,6-Hexanehexaol; Sorbo; Nivitin) as product?

Equation Result #4

H2 + CH3(CH2)7CH=CH(CH2)7CO2CH3CH3(CH2)16CO2CH3
hydrogen Methyl oleate Methyl stearate
1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Further information about equation H2 + CH3(CH2)7CH=CH(CH2)7CO2CH3 → CH3(CH2)16CO2CH3

What is reaction condition of H2 (hydrogen) reacts with CH3(CH2)7CH=CH(CH2)7CO2CH3 (Methyl oleate) ?

Temperature: temperature Solvent: Ni

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce CH3(CH2)16CO2CH3 (Methyl stearate) ?

Phenomenon after H2 (hydrogen) reacts with CH3(CH2)7CH=CH(CH2)7CO2CH3 (Methyl oleate)

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance CH3(CH2)16CO2CH3 (Methyl stearate), appearing at the end of the reaction.

Or if any of the following reactant substances CH3(CH2)7CH=CH(CH2)7CO2CH3 (Methyl oleate), disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions H2 + CH3(CH2)7CH=CH(CH2)7CO2CH3 → CH3(CH2)16CO2CH3

Questions related to reactant H2 (hydrogen)

What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?

Questions related to reactant CH3(CH2)7CH=CH(CH2)7CO2CH3 (Methyl oleate)

What are the chemical and physical characteristic of CH3(CH2)7CH=CH(CH2)7CO2CH3 (Methyl oleate)? What are the chemical reactions that have CH3(CH2)7CH=CH(CH2)7CO2CH3 (Methyl oleate) as reactant?

Questions related to product CH3(CH2)16CO2CH3 (Methyl stearate)

What are the chemical and physical characteristic of CH3(CH2)16CO2CH3 (Methyl oleate)? What are the chemical reactions that have CH3(CH2)16CO2CH3 (Methyl stearate) as product?

Equation Result #5

H2 + 2K2KH
hydrogen potassium Potassium hydride; Hydrogen potassium salt
(khí) (rắn) (rắn)
(không màu) (trắng bạc)
1 2 2 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Further information about equation H2 + 2K → 2KH

What is reaction condition of H2 (hydrogen) reacts with K (potassium) ?

Temperature: 200 - 350°C

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce KH (Potassium hydride; Hydrogen potassium salt) ?

H2 reacts with K

Phenomenon after H2 (hydrogen) reacts with K (potassium)

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance KH (Potassium hydride; Hydrogen potassium salt), appearing at the end of the reaction.

Or if any of the following reactant substances K (potassium), disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions H2 + 2K → 2KH

Questions related to reactant H2 (hydrogen)

What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?

Questions related to reactant K (potassium)

What are the chemical and physical characteristic of K (potassium)? What are the chemical reactions that have K (potassium) as reactant?

Questions related to product KH (Potassium hydride; Hydrogen potassium salt)

What are the chemical and physical characteristic of KH (potassium)? What are the chemical reactions that have KH (Potassium hydride; Hydrogen potassium salt) as product?

Breaking News

Interesting Information Only Few People Knows


Income form ads help us maintain content with highest quality why we need to place adverts ? :D

I don't want to support website (close) - :(