Advertisement

H2 = ? | Chemical Equation Balancer

hydrogen = ?

News Only 5% of POPULATION would know

Advertisement

Equation Result #1

CH3CHO + H2C2H5OH
acetaldehyde hydrogen (c2h5)2nh diethylamine
(lỏng) (khí) (lỏng)
(không màu) (không màu) (không màu)
1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Advertisement

Further information about equation CH3CHO + H2 → C2H5OH

What is reaction condition of CH3CHO (acetaldehyde) reacts with H2 (hydrogen) ?

No information found for this chemical equation

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce C2H5OH ((c2h5)2nh diethylamine) ?

CH3CHO reacts with H2

Phenomenon after CH3CHO (acetaldehyde) reacts with H2 (hydrogen)

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance C2H5OH ((c2h5)2nh diethylamine), appearing at the end of the reaction.

Or if any of the following reactant substances H2 (hydrogen), disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions CH3CHO + H2 → C2H5OH

Questions related to reactant CH3CHO (acetaldehyde)

What are the chemical and physical characteristic of CH3CHO (acetaldehyde)? What are the chemical reactions that have CH3CHO (acetaldehyde) as reactant?

Questions related to reactant H2 (hydrogen)

What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?

Questions related to product C2H5OH ((c2h5)2nh diethylamine)

What are the chemical and physical characteristic of C2H5OH (hydrogen)? What are the chemical reactions that have C2H5OH ((c2h5)2nh diethylamine) as product?
Advertisement

Equation Result #2

H2 + CH3C(CH3)=CHCH3CH3CH(CH3)CH2CH3
hydrogen 2-methylbut-2-ene 2-methylbutane
(khí) (lỏng) (lỏng)
(không màu) (không màu) (không màu)
1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Advertisement

Further information about equation H2 + CH3C(CH3)=CHCH3 → CH3CH(CH3)CH2CH3

What is reaction condition of H2 (hydrogen) reacts with CH3C(CH3)=CHCH3 (2-methylbut-2-ene) ?

Solvent: H2/Pt

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce CH3CH(CH3)CH2CH3 (2-methylbutane) ?

2-methylbut-2-en reacts with H2

Phenomenon after H2 (hydrogen) reacts with CH3C(CH3)=CHCH3 (2-methylbut-2-ene)

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance CH3CH(CH3)CH2CH3 (2-methylbutane), appearing at the end of the reaction.

Or if any of the following reactant substances CH3C(CH3)=CHCH3 (2-methylbut-2-ene), disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions H2 + CH3C(CH3)=CHCH3 → CH3CH(CH3)CH2CH3

Questions related to reactant H2 (hydrogen)

What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?

Questions related to reactant CH3C(CH3)=CHCH3 (2-methylbut-2-ene)

What are the chemical and physical characteristic of CH3C(CH3)=CHCH3 (2-methylbut-2-ene)? What are the chemical reactions that have CH3C(CH3)=CHCH3 (2-methylbut-2-ene) as reactant?

Questions related to product CH3CH(CH3)CH2CH3 (2-methylbutane)

What are the chemical and physical characteristic of CH3CH(CH3)CH2CH3 (2-methylbut-2-ene)? What are the chemical reactions that have CH3CH(CH3)CH2CH3 (2-methylbutane) as product?
Advertisement

Equation Result #3

CH3CHO + H2CH3CH2OH
acetaldehyde hydrogen
(rắn) (khí) (lỏng)
(không màu) (không màu)
1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Advertisement

Further information about equation CH3CHO + H2 → CH3CH2OH

What is reaction condition of CH3CHO (acetaldehyde) reacts with H2 (hydrogen) ?

Temperature: temperature Solvent: Ni

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce CH3CH2OH () ?

Phenomenon after CH3CHO (acetaldehyde) reacts with H2 (hydrogen)

Click to see equation's phenomenon

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions CH3CHO + H2 → CH3CH2OH

Questions related to reactant CH3CHO (acetaldehyde)

What are the chemical and physical characteristic of CH3CHO (acetaldehyde)? What are the chemical reactions that have CH3CHO (acetaldehyde) as reactant?

Questions related to reactant H2 (hydrogen)

What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?

Questions related to product CH3CH2OH ()

What are the chemical and physical characteristic of CH3CH2OH (hydrogen)? What are the chemical reactions that have CH3CH2OH () as product?

Equation Result #4

CH3COCH3 + H2CH3CHOHCH3
acetone hydrogen
(rắn) (khí) (rắn)
(không màu)
1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Further information about equation CH3COCH3 + H2 → CH3CHOHCH3

What is reaction condition of CH3COCH3 (acetone) reacts with H2 (hydrogen) ?

Temperature: temperature Solvent: Ni

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce CH3CHOHCH3 () ?

Phenomenon after CH3COCH3 (acetone) reacts with H2 (hydrogen)

Click to see equation's phenomenon

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions CH3COCH3 + H2 → CH3CHOHCH3

Questions related to reactant CH3COCH3 (acetone)

What are the chemical and physical characteristic of CH3COCH3 (acetone)? What are the chemical reactions that have CH3COCH3 (acetone) as reactant?

Questions related to reactant H2 (hydrogen)

What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?

Questions related to product CH3CHOHCH3 ()

What are the chemical and physical characteristic of CH3CHOHCH3 (hydrogen)? What are the chemical reactions that have CH3CHOHCH3 () as product?

Equation Result #5

CO + 3H2CH4 + H2O
carbon monoxide hydrogen methane water
(khí) (khí) (khí) (lỏng)
(không màu) (không màu) (không màu) (không màu)
1 3 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Further information about equation CO + 3H2 → CH4 + H2O

What is reaction condition of CO (carbon monoxide) reacts with H2 (hydrogen) ?

Temperature: 150 - 200°C Solvent: Ni

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce CH4 (methane) and H2O (water) ?

H2 reacts with CO

Phenomenon after CO (carbon monoxide) reacts with H2 (hydrogen)

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance H2O (water), appearing at the end of the reaction.

Or if any of the following reactant substances H2 (hydrogen), disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions CO + 3H2 → CH4 + H2O

Questions related to reactant CO (carbon monoxide)

What are the chemical and physical characteristic of CO (carbon monoxide)? What are the chemical reactions that have CO (carbon monoxide) as reactant?

Questions related to reactant H2 (hydrogen)

What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?

Questions related to product CH4 (methane)

What are the chemical and physical characteristic of CH4 (hydrogen)? What are the chemical reactions that have CH4 (methane) as product?

Questions related to product H2O (water)

What are the chemical and physical characteristic of H2O (hydrogen)? What are the chemical reactions that have H2O (water) as product?

Breaking News

Interesting Information Only Few People Knows


Income form ads help us maintain content with highest quality why we need to place adverts ? :D

I don't want to support website (close) - :(