Advertisement

CH2=CHCH3 = ? | Chemical Equation Balancer

Chemical equation search results

News Only 5% of POPULATION would know

Advertisement

Equation Result #1

C6H6 + CH2=CHCH3C6H5CH(CH3)2
benzene
(lỏng) (khí) (lỏng)
(không màu) (không màu) (không màu)
1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Advertisement

Further information about equation C6H6 + CH2=CHCH3 → C6H5CH(CH3)2

What is reaction condition of C6H6 (benzene) reacts with CH2=CHCH3 () ?

Other Condition: H+

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce C6H5CH(CH3)2 () ?

Benzene reacts with propene

Phenomenon after C6H6 (benzene) reacts with CH2=CHCH3 ()

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance C6H5CH(CH3)2, appearing at the end of the reaction.

Or if any of the following reactant substances CH2=CHCH3, disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions C6H6 + CH2=CHCH3 → C6H5CH(CH3)2

Questions related to reactant C6H6 (benzene)

What are the chemical and physical characteristic of C6H6 (benzene)? What are the chemical reactions that have C6H6 (benzene) as reactant?

Questions related to reactant CH2=CHCH3 ()

What are the chemical and physical characteristic of CH2=CHCH3 ()? What are the chemical reactions that have CH2=CHCH3 () as reactant?

Questions related to product C6H5CH(CH3)2 ()

What are the chemical and physical characteristic of C6H5CH(CH3)2 ()? What are the chemical reactions that have C6H5CH(CH3)2 () as product?
Advertisement

Equation Result #2

Br2 + CH2=CHCH3CH2(Br)-CH(Br)-CH3
bromine Propylene bromide; 1,2-Dibromopropane; Propylene dibromide
(dung dịch) (khí) (khí)
1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Advertisement

Further information about equation Br2 + CH2=CHCH3 → CH2(Br)-CH(Br)-CH3

What is reaction condition of Br2 (bromine) reacts with CH2=CHCH3 () ?

No information found for this chemical equation

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce CH2(Br)-CH(Br)-CH3 (Propylene bromide; 1,2-Dibromopropane; Propylene dibromide) ?

Propene reacts with Br2

Phenomenon after Br2 (bromine) reacts with CH2=CHCH3 ()

Click to see equation's phenomenon

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions Br2 + CH2=CHCH3 → CH2(Br)-CH(Br)-CH3

Questions related to reactant Br2 (bromine)

What are the chemical and physical characteristic of Br2 (bromine)? What are the chemical reactions that have Br2 (bromine) as reactant?

Questions related to reactant CH2=CHCH3 ()

What are the chemical and physical characteristic of CH2=CHCH3 ()? What are the chemical reactions that have CH2=CHCH3 () as reactant?

Questions related to product CH2(Br)-CH(Br)-CH3 (Propylene bromide; 1,2-Dibromopropane; Propylene dibromide)

What are the chemical and physical characteristic of CH2(Br)-CH(Br)-CH3 ()? What are the chemical reactions that have CH2(Br)-CH(Br)-CH3 (Propylene bromide; 1,2-Dibromopropane; Propylene dibromide) as product?
Advertisement

Equation Result #3

H2 + CH2=CHCH3CH3-CH2-CH3
hydrogen
(khí) (khí) (khí)
(không màu)
1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Advertisement

Further information about equation H2 + CH2=CHCH3 → CH3-CH2-CH3

What is reaction condition of H2 (hydrogen) reacts with CH2=CHCH3 () ?

No information found for this chemical equation

Explanation: The ideal environmental conditions for a reaction, such as temperature, pressure, catalysts, and solvent. Catalysts are substances that speed up the pace (velocity) of a chemical reaction without being consumed or becoming part of the end product. Catalysts have no effect on equilibrium situations.

How reactions can happened and produce CH3-CH2-CH3 () ?

Propene reacts with H2

Phenomenon after H2 (hydrogen) reacts with CH2=CHCH3 ()

This equation does not have any specific information about phenomenon.

In this case, you just need to observe to see if product substance CH3-CH2-CH3, appearing at the end of the reaction.

Or if any of the following reactant substances CH2=CHCH3, disappearing

What are other important informations you should know about reaction

We no further information about this chemical reactions.

Categories of equation


Further questions related to chemical reactions H2 + CH2=CHCH3 → CH3-CH2-CH3

Questions related to reactant H2 (hydrogen)

What are the chemical and physical characteristic of H2 (hydrogen)? What are the chemical reactions that have H2 (hydrogen) as reactant?

Questions related to reactant CH2=CHCH3 ()

What are the chemical and physical characteristic of CH2=CHCH3 ()? What are the chemical reactions that have CH2=CHCH3 () as reactant?

Questions related to product CH3-CH2-CH3 ()

What are the chemical and physical characteristic of CH3-CH2-CH3 ()? What are the chemical reactions that have CH3-CH2-CH3 () as product?

Breaking News

Interesting Information Only Few People Knows


Income form ads help us maintain content with highest quality why we need to place adverts ? :D

I don't want to support website (close) - :(