Advertisement

? = CH3[CH2]7CH=CH[CH2]7COOCH3 | Chemical Equation Balancer

Chemical equation search results

News Only 5% of POPULATION would know

Advertisement

News Only 5% of POPULATION would know

Advertisement

Searching in our database with more than 5552 chemical substances

CH3[CH2]7CH=CH[CH2]7COOCH3

short form



metyl oleat



Combination reaction

Also known as a synthesis reaction. One kind of frequently occurring combination reaction is the reaction of an element with oxygen to form an oxide. Under certain conditions, metals and nonmetals both react readily with oxygen. Once ignited, magnesium reacts rapidly and dramatically, reacting with oxygen from the air to create a fine magnesium oxide powder.

H2O + K2CO3 + CO2 → 2KHCO3 Ca3(PO4)2 + H3PO4 → 3CaHPO4 2P + 5S → P2S5 2Mg + O2 → 2MgO SnCl4 + Sn → 2SnCl2 BaO + H2O → Ba(OH)2 H2O + ZnO → Zn(OH)2 View All Combination reaction
Advertisement

Decomposition reaction

Many decomposition reactions involve heat , light, or electricity to input energy. Binary compounds are compounds which consist of only two elements. The simplest sort of reaction to decomposition is when a binary compound breaks down into its elements. Mercury (II) oxide, a red solid, decomposes to form mercury and oxygen gas when heated. Also, a reaction is regarded as a decomposition reaction even if one or more of the products are still a compound. A metal carbonate breaks down to form a metal oxide and carbon dioxide gas. Calcium carbonate for example decomposes into calcium oxide and carbon dioxide.

C2H5Cl → C2H4 + HCl 2KMnO4 → MnO2 + O2 + K2MnO4 2KClO3 → 2KCl + 3O2 2CH4 → C2H2 + 2H2 2Cu(NO3)2 → 2CuO + 4NO2 + O2 CH4 → C + 2H2 BaCl2 → Cl2 + Ba View All Decomposition reaction
Advertisement

Oxidation-reduction reaction

An oxidation-reduction (redox) reaction is a type of chemical reaction that involves a transfer of electrons between two species. An oxidation-reduction reaction is any chemical reaction in which the oxidation number of a molecule, atom, or ion changes by gaining or losing an electron. Redox reactions are common and vital to some of the basic functions of life, including photosynthesis, respiration, combustion, and corrosion or rusting.

2KOH + CO2 → H2O + K2CO3 CO + H2O → H2 + CO2 Cl2 + 2HBr → Br2 + 2HCl 3CuS + 8HNO3 → 3Cu(NO3)2 + 4H2O + 2NO + 3S 2O2 + SiH4 → 2H2O + SiO2 2SO2 + Zn → ZnS2O4 2F2 + 2H2O → O2 + 4HF View All Oxidation-reduction reaction
Advertisement

Single-replacement reaction

A + BC → AC + B Element A is a metal in this general reaction and replaces element B, a metal in the compound as well. If the replacement element is a non-metal, it must replace another non-metal in a compound, and it becomes the general equation. Many metals easily react with acids, and one of the reaction products when they do so is hydrogen gas. Zinc reacts to the aqueous zinc chloride and hydrogen with hydrochloride acid (see figure below).

Cl2 + 2NaBr → Br2 + 2NaCl Fe + CuSO4 → Cu + FeSO4 Cu(NO3)2 + Fe → Cu + Fe(NO3)2 C2H5OH + CH3COOH → H2O + CH3COOC2H5 CH3Cl + CH3COOH → HCl + CH3COOCH3 H2O + CH3COCl → CH3COOH + HCl 4Al + 3SiO2 → 2Al2O3 + 3Si View All Single-replacement reaction
Advertisement

Double-replacement reaction

AB + CD → AD + CB A and C are positive charged cations in this reaction, while B and D are negative charged anions. Double-replacement reactions typically occur in aqueous solution between the compounds. To cause a reaction, one of the products is usually a solid precipitate, a gas, or a molecular compound like water. A precipitate forms in a double-replacement reaction when the cations from one reactant combine to form an insoluble ionic compound with the anions from the other reactant. The following reaction occurs when aqueous solutions of potassium iodide and lead ( II) nitrate are blended.

Na2SO3 + MgSO4 → Na2SO4 + MgSO3 3H2O + 3NH3 + FeCl3 → 3NH4Cl + Fe(OH)3 2AgNO3 + Na2SO4 → 2NaNO3 + Ag2SO4 2HNO3 + MgO → H2O + Mg(NO3)2 8Al + 15H2SO4 → 4Al2(SO4)3 + 12H2O + 3H2S FeCl2 + 2NaOH → 2NaCl + Fe(OH)2 K2CO3 + 2NaHSO4 → H2O + Na2SO4 + K2SO4 + CO2 View All Double-replacement reaction
Advertisement
Advertisement

You cound not find ?

Please try our customized search system to focus to Google Chemistry Search result only


Equations with CH3[CH2]7CH=CH[CH2]7COOCH3 as product

View all equations with CH3[CH2]7CH=CH[CH2]7COOCH3 as product
Advertisement
Advertisement

Breaking News

Interesting Information Only Few People Knows


Income form ads help us maintain content with highest quality why we need to place adverts ? :D

I don't want to support website (close) - :(